C15H22N2 — CID 141230822
N'-but-3-ynyl-N'-[(4-methylphenyl)methyl]propane-1,3-diamine (PubChem CID 141230822) has the molecular formula C15H22N2 and a molecular weight of 230.36 g/mol. Its IUPAC name is N'-but-3-ynyl-N'-[(4-methylphenyl)methyl]propane-1,3-diamine.
| Compound Name | N'-but-3-ynyl-N'-[(4-methylphenyl)methyl]propane-1,3-diamine |
|---|---|
| PubChem CID | 141230822 |
| Molecular Formula | C15H22N2 |
| Molecular Weight | 230.36 g/mol |
| Exact Mass | 230.18 |
| IUPAC Name | N'-but-3-ynyl-N'-[(4-methylphenyl)methyl]propane-1,3-diamine |
| SMILES | C#CCCN(CCCN)Cc1ccc(C)cc1 |
| InChI | InChI=1S/C15H22N2/c1-3-4-11-17(12-5-10-16)13-15-8-6-14(2)7-9-15/h1,6-9H,4-5,10-13,16H2,2H3 |
| InChIKey | YYTAHELTFDVYGZ-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.36 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|