C22H29N3 — CID 23934196
4-[[3-aminopropyl-[(4-tert-butylphenyl)methyl]amino]methyl]benzonitrile (PubChem CID 23934196) has the molecular formula C22H29N3 and a molecular weight of 335.50 g/mol. Its IUPAC name is 4-[[3-aminopropyl-[(4-tert-butylphenyl)methyl]amino]methyl]benzonitrile.
| Compound Name | 4-[[3-aminopropyl-[(4-tert-butylphenyl)methyl]amino]methyl]benzonitrile |
|---|---|
| PubChem CID | 23934196 |
| Molecular Formula | C22H29N3 |
| Molecular Weight | 335.50 g/mol |
| Exact Mass | 335.24 |
| IUPAC Name | 4-[[3-aminopropyl-[(4-tert-butylphenyl)methyl]amino]methyl]benzonitrile |
| SMILES | CC(C)(C)c1ccc(CN(CCCN)Cc2ccc(C#N)cc2)cc1 |
| InChI | InChI=1S/C22H29N3/c1-22(2,3)21-11-9-20(10-12-21)17-25(14-4-13-23)16-19-7-5-18(15-24)6-8-19/h5-12H,4,13-14,16-17,23H2,1-3H3 |
| InChIKey | SZAIYPHNBATTES-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 53.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.50 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |