C11H20N4 — CID 91052537
N'-[2-[amino(benzyl)amino]ethyl]ethane-1,2-diamine (PubChem CID 91052537) has the molecular formula C11H20N4 and a molecular weight of 208.31 g/mol. Its IUPAC name is N'-[2-[amino(benzyl)amino]ethyl]ethane-1,2-diamine.
| Compound Name | N'-[2-[amino(benzyl)amino]ethyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 91052537 |
| Molecular Formula | C11H20N4 |
| Molecular Weight | 208.31 g/mol |
| Exact Mass | 208.17 |
| IUPAC Name | N'-[2-[amino(benzyl)amino]ethyl]ethane-1,2-diamine |
| SMILES | NCCNCCN(N)Cc1ccccc1 |
| InChI | InChI=1S/C11H20N4/c12-6-7-14-8-9-15(13)10-11-4-2-1-3-5-11/h1-5,14H,6-10,12-13H2 |
| InChIKey | ZJNUYFQVMNGXOY-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 67.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.31 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|