C23H43GdN3O11 — CID 57348310
acetic acid;N'-[2-[benzyl(ethoxy)amino]ethyl]ethane-1,2-diamine;gadolinium (PubChem CID 57348310) has the molecular formula C23H43GdN3O11 and a molecular weight of 694.86 g/mol. Its IUPAC name is acetic acid;N'-[2-[benzyl(ethoxy)amino]ethyl]ethane-1,2-diamine;gadolinium.
| Compound Name | acetic acid;N'-[2-[benzyl(ethoxy)amino]ethyl]ethane-1,2-diamine;gadolinium |
|---|---|
| PubChem CID | 57348310 |
| Molecular Formula | C23H43GdN3O11 |
| Molecular Weight | 694.86 g/mol |
| Exact Mass | 695.21 |
| IUPAC Name | acetic acid;N'-[2-[benzyl(ethoxy)amino]ethyl]ethane-1,2-diamine;gadolinium |
| SMILES | CC(=O)O.CC(=O)O.CC(=O)O.CC(=O)O.CC(=O)O.CCON(CCNCCN)Cc1ccccc1.[Gd] |
| InChI | InChI=1S/C13H23N3O.5C2H4O2.Gd/c1-2-17-16(11-10-15-9-8-14)12-13-6-4-3-5-7-13;5*1-2(3)4;/h3-7,15H,2,8-12,14H2,1H3;5*1H3,(H,3,4); |
| InChIKey | JYHSLOLAKOJLMR-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 237.02 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.86 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|