C13H21N3 — CID 70389657
N'-[2-[benzyl(ethenyl)amino]ethyl]ethane-1,2-diamine (PubChem CID 70389657) has the molecular formula C13H21N3 and a molecular weight of 219.33 g/mol. Its IUPAC name is N'-[2-[benzyl(ethenyl)amino]ethyl]ethane-1,2-diamine.
| Compound Name | N'-[2-[benzyl(ethenyl)amino]ethyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 70389657 |
| Molecular Formula | C13H21N3 |
| Molecular Weight | 219.33 g/mol |
| Exact Mass | 219.17 |
| IUPAC Name | N'-[2-[benzyl(ethenyl)amino]ethyl]ethane-1,2-diamine |
| SMILES | C=CN(CCNCCN)Cc1ccccc1 |
| InChI | InChI=1S/C13H21N3/c1-2-16(11-10-15-9-8-14)12-13-6-4-3-5-7-13/h2-7,15H,1,8-12,14H2 |
| InChIKey | JKKWWVBUIPNOSW-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.33 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|