C17H30N2O3Si — CID 174815417
3-[2-[benzyl(ethenyl)amino]ethylamino]-1-[dimethoxy(methyl)silyl]propan-1-ol (PubChem CID 174815417) has the molecular formula C17H30N2O3Si and a molecular weight of 338.52 g/mol. Its IUPAC name is 3-[2-[benzyl(ethenyl)amino]ethylamino]-1-[dimethoxy(methyl)silyl]propan-1-ol.
| Compound Name | 3-[2-[benzyl(ethenyl)amino]ethylamino]-1-[dimethoxy(methyl)silyl]propan-1-ol |
|---|---|
| PubChem CID | 174815417 |
| Molecular Formula | C17H30N2O3Si |
| Molecular Weight | 338.52 g/mol |
| Exact Mass | 338.20 |
| IUPAC Name | 3-[2-[benzyl(ethenyl)amino]ethylamino]-1-[dimethoxy(methyl)silyl]propan-1-ol |
| SMILES | C=CN(CCNCCC(O)[Si](C)(OC)OC)Cc1ccccc1 |
| InChI | InChI=1S/C17H30N2O3Si/c1-5-19(15-16-9-7-6-8-10-16)14-13-18-12-11-17(20)23(4,21-2)22-3/h5-10,17-18,20H,1,11-15H2,2-4H3 |
| InChIKey | CLKKNBGXXZDQKX-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 53.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.52 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|