C24H40N2O4Si — CID 154000557
3-[4-[2-[benzyl(ethenyl)amino]ethylamino]butoxy-methoxy-methylsilyl]propyl 2-methylprop-2-enoate (PubChem CID 154000557) has the molecular formula C24H40N2O4Si and a molecular weight of 448.68 g/mol. Its IUPAC name is 3-[4-[2-[benzyl(ethenyl)amino]ethylamino]butoxy-methoxy-methylsilyl]propyl 2-methylprop-2-enoate.
| Compound Name | 3-[4-[2-[benzyl(ethenyl)amino]ethylamino]butoxy-methoxy-methylsilyl]propyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 154000557 |
| Molecular Formula | C24H40N2O4Si |
| Molecular Weight | 448.68 g/mol |
| Exact Mass | 448.28 |
| IUPAC Name | 3-[4-[2-[benzyl(ethenyl)amino]ethylamino]butoxy-methoxy-methylsilyl]propyl 2-methylprop-2-enoate |
| SMILES | C=CN(CCNCCCCO[Si](C)(CCCOC(=O)C(=C)C)OC)Cc1ccccc1 |
| InChI | InChI=1S/C24H40N2O4Si/c1-6-26(21-23-13-8-7-9-14-23)17-16-25-15-10-11-19-30-31(5,28-4)20-12-18-29-24(27)22(2)3/h6-9,13-14,25H,1-2,10-12,15-21H2,3-5H3 |
| InChIKey | QSNWCSWCMIQLER-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.68 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|