About N'-benzyl-N'-(2H-tetrazol-5-ylmethyl)ethane-1,2-diamine
N'-benzyl-N'-(2H-tetrazol-5-ylmethyl)ethane-1,2-diamine (PubChem CID 130589983) has the molecular formula C11H16N6
and a molecular weight of 232.29 g/mol. Its IUPAC name is N'-benzyl-N'-(2H-tetrazol-5-ylmethyl)ethane-1,2-diamine.
Molecular Properties
| Compound Name | N'-benzyl-N'-(2H-tetrazol-5-ylmethyl)ethane-1,2-diamine |
| PubChem CID | 130589983 |
| Molecular Formula | C11H16N6 |
| Molecular Weight | 232.29 g/mol |
| Exact Mass | 232.14 |
| IUPAC Name | N'-benzyl-N'-(2H-tetrazol-5-ylmethyl)ethane-1,2-diamine |
| SMILES | NCCN(Cc1ccccc1)Cc1nn[nH]n1 |
| InChI | InChI=1S/C11H16N6/c12-6-7-17(9-11-13-15-16-14-11)8-10-4-2-1-3-5-10/h1-5H,6-9,12H2,(H,13,14,15,16) |
| InChIKey | UUOIFRHZNBQSJH-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 83.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.29 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N'-benzyl-N'-(2H-tetrazol-5-ylmethyl)ethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-benzyl-N'-(2H-tetrazol-5-ylmethyl)ethane-1,2-diamine?
The IUPAC name of N'-benzyl-N'-(2H-tetrazol-5-ylmethyl)ethane-1,2-diamine (CID 130589983) is N'-benzyl-N'-(2H-tetrazol-5-ylmethyl)ethane-1,2-diamine.
What is the SMILES notation for N'-benzyl-N'-(2H-tetrazol-5-ylmethyl)ethane-1,2-diamine?
The canonical SMILES for N'-benzyl-N'-(2H-tetrazol-5-ylmethyl)ethane-1,2-diamine is NCCN(Cc1ccccc1)Cc1nn[nH]n1.
What is the InChIKey of N'-benzyl-N'-(2H-tetrazol-5-ylmethyl)ethane-1,2-diamine?
The InChIKey is UUOIFRHZNBQSJH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N6/c12-6-7-17(9-11-13-15-16-14-11)8-10-4-2-1-3-5-10/h1-5H,6-9,12H2,(H,13,14,15,16).
What are the key properties of N'-benzyl-N'-(2H-tetrazol-5-ylmethyl)ethane-1,2-diamine?
N'-benzyl-N'-(2H-tetrazol-5-ylmethyl)ethane-1,2-diamine has a molecular weight of 232.29 g/mol, XLogP of 0.16, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N'-benzyl-N'-(2H-tetrazol-5-ylmethyl)ethane-1,2-diamine is sourced from PubChem (CID 130589983), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).