C22H31N23O — CID 118303920
N-[2-[[2-phenylmethoxy-1-(2H-tetrazol-5-yl)ethyl]-(2H-tetrazol-5-ylmethyl)amino]ethyl]-N,N',N'-tris(2H-tetrazol-5-ylmethyl)ethane-1,2-diamine (PubChem CID 118303920) has the molecular formula C22H31N23O and a molecular weight of 633.65 g/mol. Its IUPAC name is N-[2-[[2-phenylmethoxy-1-(2H-tetrazol-5-yl)ethyl]-(2H-tetrazol-5-ylmethyl)amino]ethyl]-N,N',N'-tris(2H-tetrazol-5-ylmethyl)ethane-1,2-diamine.
| Compound Name | N-[2-[[2-phenylmethoxy-1-(2H-tetrazol-5-yl)ethyl]-(2H-tetrazol-5-ylmethyl)amino]ethyl]-N,N',N'-tris(2H-tetrazol-5-ylmethyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 118303920 |
| Molecular Formula | C22H31N23O |
| Molecular Weight | 633.65 g/mol |
| Exact Mass | 633.31 |
| IUPAC Name | N-[2-[[2-phenylmethoxy-1-(2H-tetrazol-5-yl)ethyl]-(2H-tetrazol-5-ylmethyl)amino]ethyl]-N,N',N'-tris(2H-tetrazol-5-ylmethyl)ethane-1,2-diamine |
| SMILES | c1ccc(COCC(c2nn[nH]n2)N(CCN(CCN(Cc2nn[nH]n2)Cc2nn[nH]n2)Cc2nn[nH]n2)Cc2nn[nH]n2)cc1 |
| InChI | InChI=1S/C22H31N23O/c1-2-4-16(5-3-1)14-46-15-17(22-31-41-42-32-22)45(13-21-29-39-40-30-21)9-8-43(10-18-23-33-34-24-18)6-7-44(11-19-25-35-36-26-19)12-20-27-37-38-28-20/h1-5,17H,6-15H2,(H,23,24,33,34)(H,25,26,35,36)(H,27,28,37,38)(H,29,30,39,40)(H,31,32,41,42) |
| InChIKey | YPXYZQPUXOOJNK-UHFFFAOYSA-N |
| XLogP | -2.78 |
| TPSA | 291.25 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 19 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.65 |
| LogP ≤ 5 | -2.78 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 19 |