C34H36N3P — CID 174847852
N',N'-dibenzylethane-1,2-diamine;2-diphenylphosphanylaniline (PubChem CID 174847852) has the molecular formula C34H36N3P and a molecular weight of 517.66 g/mol. Its IUPAC name is N',N'-dibenzylethane-1,2-diamine;2-diphenylphosphanylaniline.
| Compound Name | N',N'-dibenzylethane-1,2-diamine;2-diphenylphosphanylaniline |
|---|---|
| PubChem CID | 174847852 |
| Molecular Formula | C34H36N3P |
| Molecular Weight | 517.66 g/mol |
| Exact Mass | 517.26 |
| IUPAC Name | N',N'-dibenzylethane-1,2-diamine;2-diphenylphosphanylaniline |
| SMILES | NCCN(Cc1ccccc1)Cc1ccccc1.Nc1ccccc1P(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H16NP.C16H20N2/c19-17-13-7-8-14-18(17)20(15-9-3-1-4-10-15)16-11-5-2-6-12-16;17-11-12-18(13-15-7-3-1-4-8-15)14-16-9-5-2-6-10-16/h1-14H,19H2;1-10H,11-14,17H2 |
| InChIKey | YHZLJXDHIXSYTO-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 55.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.66 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|