C13H18Cl3N3 — CID 22335194
N-benzyl-2-chloro-N-(1H-imidazol-5-ylmethyl)ethanamine;dihydrochloride (PubChem CID 22335194) has the molecular formula C13H18Cl3N3 and a molecular weight of 322.67 g/mol. Its IUPAC name is N-benzyl-2-chloro-N-(1H-imidazol-5-ylmethyl)ethanamine;dihydrochloride.
| Compound Name | N-benzyl-2-chloro-N-(1H-imidazol-5-ylmethyl)ethanamine;dihydrochloride |
|---|---|
| PubChem CID | 22335194 |
| Molecular Formula | C13H18Cl3N3 |
| Molecular Weight | 322.67 g/mol |
| Exact Mass | 321.06 |
| IUPAC Name | N-benzyl-2-chloro-N-(1H-imidazol-5-ylmethyl)ethanamine;dihydrochloride |
| SMILES | Cl.Cl.ClCCN(Cc1ccccc1)Cc1cnc[nH]1 |
| InChI | InChI=1S/C13H16ClN3.2ClH/c14-6-7-17(10-13-8-15-11-16-13)9-12-4-2-1-3-5-12;;/h1-5,8,11H,6-7,9-10H2,(H,15,16);2*1H |
| InChIKey | NRTFFPXBXVACLE-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 31.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.67 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|