C15H24N2O4 — CID 82959006
2-[butyl-[(4-hydroxy-3,5-dimethoxyphenyl)methyl]amino]acetamide (PubChem CID 82959006) has the molecular formula C15H24N2O4 and a molecular weight of 296.37 g/mol. Its IUPAC name is 2-[butyl-[(4-hydroxy-3,5-dimethoxyphenyl)methyl]amino]acetamide.
| Compound Name | 2-[butyl-[(4-hydroxy-3,5-dimethoxyphenyl)methyl]amino]acetamide |
|---|---|
| PubChem CID | 82959006 |
| Molecular Formula | C15H24N2O4 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.17 |
| IUPAC Name | 2-[butyl-[(4-hydroxy-3,5-dimethoxyphenyl)methyl]amino]acetamide |
| SMILES | CCCCN(CC(N)=O)Cc1cc(OC)c(O)c(OC)c1 |
| InChI | InChI=1S/C15H24N2O4/c1-4-5-6-17(10-14(16)18)9-11-7-12(20-2)15(19)13(8-11)21-3/h7-8,19H,4-6,9-10H2,1-3H3,(H2,16,18) |
| InChIKey | DSFGVTXYGVUIBQ-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 85.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |