C13H20N4O3 — CID 106785478
2-[[4-(aminomethyl)-3-methoxyphenyl]methyl-(2-amino-2-oxoethyl)amino]acetamide (PubChem CID 106785478) has the molecular formula C13H20N4O3 and a molecular weight of 280.33 g/mol. Its IUPAC name is 2-[[4-(aminomethyl)-3-methoxyphenyl]methyl-(2-amino-2-oxoethyl)amino]acetamide.
| Compound Name | 2-[[4-(aminomethyl)-3-methoxyphenyl]methyl-(2-amino-2-oxoethyl)amino]acetamide |
|---|---|
| PubChem CID | 106785478 |
| Molecular Formula | C13H20N4O3 |
| Molecular Weight | 280.33 g/mol |
| Exact Mass | 280.15 |
| IUPAC Name | 2-[[4-(aminomethyl)-3-methoxyphenyl]methyl-(2-amino-2-oxoethyl)amino]acetamide |
| SMILES | COc1cc(CN(CC(N)=O)CC(N)=O)ccc1CN |
| InChI | InChI=1S/C13H20N4O3/c1-20-11-4-9(2-3-10(11)5-14)6-17(7-12(15)18)8-13(16)19/h2-4H,5-8,14H2,1H3,(H2,15,18)(H2,16,19) |
| InChIKey | UPICELSHQZFSQB-UHFFFAOYSA-N |
| XLogP | -1.07 |
| TPSA | 124.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.33 |
| LogP ≤ 5 | -1.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |