C11H18N2O3 — CID 83002999
4-[(2,2-dimethylhydrazinyl)methyl]-2,6-dimethoxyphenol (PubChem CID 83002999) has the molecular formula C11H18N2O3 and a molecular weight of 226.28 g/mol. Its IUPAC name is 4-[(2,2-dimethylhydrazinyl)methyl]-2,6-dimethoxyphenol.
| Compound Name | 4-[(2,2-dimethylhydrazinyl)methyl]-2,6-dimethoxyphenol |
|---|---|
| PubChem CID | 83002999 |
| Molecular Formula | C11H18N2O3 |
| Molecular Weight | 226.28 g/mol |
| Exact Mass | 226.13 |
| IUPAC Name | 4-[(2,2-dimethylhydrazinyl)methyl]-2,6-dimethoxyphenol |
| SMILES | COc1cc(CNN(C)C)cc(OC)c1O |
| InChI | InChI=1S/C11H18N2O3/c1-13(2)12-7-8-5-9(15-3)11(14)10(6-8)16-4/h5-6,12,14H,7H2,1-4H3 |
| InChIKey | BTRALIBVHMBAKB-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 53.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.28 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|