C13H11F4NO4 — CID 167726699
2-[3-fluoro-5-(trifluoromethyl)phenyl]-2-(prop-2-enoxycarbonylamino)acetic acid (PubChem CID 167726699) has the molecular formula C13H11F4NO4 and a molecular weight of 321.23 g/mol. Its IUPAC name is 2-[3-fluoro-5-(trifluoromethyl)phenyl]-2-(prop-2-enoxycarbonylamino)acetic acid.
| Compound Name | 2-[3-fluoro-5-(trifluoromethyl)phenyl]-2-(prop-2-enoxycarbonylamino)acetic acid |
|---|---|
| PubChem CID | 167726699 |
| Molecular Formula | C13H11F4NO4 |
| Molecular Weight | 321.23 g/mol |
| Exact Mass | 321.06 |
| IUPAC Name | 2-[3-fluoro-5-(trifluoromethyl)phenyl]-2-(prop-2-enoxycarbonylamino)acetic acid |
| SMILES | C=CCOC(=O)NC(C(=O)O)c1cc(F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H11F4NO4/c1-2-3-22-12(21)18-10(11(19)20)7-4-8(13(15,16)17)6-9(14)5-7/h2,4-6,10H,1,3H2,(H,18,21)(H,19,20) |
| InChIKey | WHJNLYABBGOCEB-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.23 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|