C16H17NO7 — CID 15505909
2-(prop-2-enoxycarbonylamino)-2-(4-prop-2-enoxycarbonyloxyphenyl)acetic acid (PubChem CID 15505909) has the molecular formula C16H17NO7 and a molecular weight of 335.31 g/mol. Its IUPAC name is 2-(prop-2-enoxycarbonylamino)-2-(4-prop-2-enoxycarbonyloxyphenyl)acetic acid.
| Compound Name | 2-(prop-2-enoxycarbonylamino)-2-(4-prop-2-enoxycarbonyloxyphenyl)acetic acid |
|---|---|
| PubChem CID | 15505909 |
| Molecular Formula | C16H17NO7 |
| Molecular Weight | 335.31 g/mol |
| Exact Mass | 335.10 |
| IUPAC Name | 2-(prop-2-enoxycarbonylamino)-2-(4-prop-2-enoxycarbonyloxyphenyl)acetic acid |
| SMILES | C=CCOC(=O)NC(C(=O)O)c1ccc(OC(=O)OCC=C)cc1 |
| InChI | InChI=1S/C16H17NO7/c1-3-9-22-15(20)17-13(14(18)19)11-5-7-12(8-6-11)24-16(21)23-10-4-2/h3-8,13H,1-2,9-10H2,(H,17,20)(H,18,19) |
| InChIKey | AJRAAUXJTYBSPT-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 111.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.31 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|