C17H17NO7S — CID 87297584
2-(4-methylsulfonyloxyphenyl)-2-(phenylmethoxycarbonylamino)acetic acid (PubChem CID 87297584) has the molecular formula C17H17NO7S and a molecular weight of 379.39 g/mol. Its IUPAC name is 2-(4-methylsulfonyloxyphenyl)-2-(phenylmethoxycarbonylamino)acetic acid.
| Compound Name | 2-(4-methylsulfonyloxyphenyl)-2-(phenylmethoxycarbonylamino)acetic acid |
|---|---|
| PubChem CID | 87297584 |
| Molecular Formula | C17H17NO7S |
| Molecular Weight | 379.39 g/mol |
| Exact Mass | 379.07 |
| IUPAC Name | 2-(4-methylsulfonyloxyphenyl)-2-(phenylmethoxycarbonylamino)acetic acid |
| SMILES | CS(=O)(=O)Oc1ccc(C(NC(=O)OCc2ccccc2)C(=O)O)cc1 |
| InChI | InChI=1S/C17H17NO7S/c1-26(22,23)25-14-9-7-13(8-10-14)15(16(19)20)18-17(21)24-11-12-5-3-2-4-6-12/h2-10,15H,11H2,1H3,(H,18,21)(H,19,20) |
| InChIKey | BMNGWPLGJUIAKA-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 119.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.39 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|