C19H28O3 — CID 59134632
methyl 4-[[4-(2-methylpropyl)phenoxy]methyl]cyclohexane-1-carboxylate (PubChem CID 59134632) has the molecular formula C19H28O3 and a molecular weight of 304.43 g/mol. Its IUPAC name is methyl 4-[[4-(2-methylpropyl)phenoxy]methyl]cyclohexane-1-carboxylate.
| Compound Name | methyl 4-[[4-(2-methylpropyl)phenoxy]methyl]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 59134632 |
| Molecular Formula | C19H28O3 |
| Molecular Weight | 304.43 g/mol |
| Exact Mass | 304.20 |
| IUPAC Name | methyl 4-[[4-(2-methylpropyl)phenoxy]methyl]cyclohexane-1-carboxylate |
| SMILES | COC(=O)C1CCC(COc2ccc(CC(C)C)cc2)CC1 |
| InChI | InChI=1S/C19H28O3/c1-14(2)12-15-6-10-18(11-7-15)22-13-16-4-8-17(9-5-16)19(20)21-3/h6-7,10-11,14,16-17H,4-5,8-9,12-13H2,1-3H3 |
| InChIKey | DRDWDTJBTWHYDT-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.43 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |