C22H27NO3 — CID 118176607
ethyl (3S)-3-[[4-(cyclopropylmethoxy)phenyl]methylamino]-3-phenylpropanoate (PubChem CID 118176607) has the molecular formula C22H27NO3 and a molecular weight of 353.46 g/mol. Its IUPAC name is ethyl (3S)-3-[[4-(cyclopropylmethoxy)phenyl]methylamino]-3-phenylpropanoate.
| Compound Name | ethyl (3S)-3-[[4-(cyclopropylmethoxy)phenyl]methylamino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 118176607 |
| Molecular Formula | C22H27NO3 |
| Molecular Weight | 353.46 g/mol |
| Exact Mass | 353.20 |
| IUPAC Name | ethyl (3S)-3-[[4-(cyclopropylmethoxy)phenyl]methylamino]-3-phenylpropanoate |
| SMILES | CCOC(=O)C[C@H](NCc1ccc(OCC2CC2)cc1)c1ccccc1 |
| InChI | InChI=1S/C22H27NO3/c1-2-25-22(24)14-21(19-6-4-3-5-7-19)23-15-17-10-12-20(13-11-17)26-16-18-8-9-18/h3-7,10-13,18,21,23H,2,8-9,14-16H2,1H3/t21-/m0/s1 |
| InChIKey | XSSIFISQHIMEFY-NRFANRHFSA-N |
| XLogP | 4.26 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.46 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |