C26H36O6S2 — CID 163530782
2-methyl-3-pentylsulfanylbenzoic acid;2-methyl-3-pentylsulfonylbenzoic acid (PubChem CID 163530782) has the molecular formula C26H36O6S2 and a molecular weight of 508.70 g/mol. Its IUPAC name is 2-methyl-3-pentylsulfanylbenzoic acid;2-methyl-3-pentylsulfonylbenzoic acid.
| Compound Name | 2-methyl-3-pentylsulfanylbenzoic acid;2-methyl-3-pentylsulfonylbenzoic acid |
|---|---|
| PubChem CID | 163530782 |
| Molecular Formula | C26H36O6S2 |
| Molecular Weight | 508.70 g/mol |
| Exact Mass | 508.20 |
| IUPAC Name | 2-methyl-3-pentylsulfanylbenzoic acid;2-methyl-3-pentylsulfonylbenzoic acid |
| SMILES | CCCCCS(=O)(=O)c1cccc(C(=O)O)c1C.CCCCCSc1cccc(C(=O)O)c1C |
| InChI | InChI=1S/C13H18O4S.C13H18O2S/c1-3-4-5-9-18(16,17)12-8-6-7-11(10(12)2)13(14)15;1-3-4-5-9-16-12-8-6-7-11(10(12)2)13(14)15/h6-8H,3-5,9H2,1-2H3,(H,14,15);6-8H,3-5,9H2,1-2H3,(H,14,15) |
| InChIKey | DSUWNQVHELXWGT-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 108.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.70 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|