C13H18O6S2 — CID 106726685
2-methyl-3-(2-propylsulfonylethylsulfonyl)benzoic acid (PubChem CID 106726685) has the molecular formula C13H18O6S2 and a molecular weight of 334.42 g/mol. Its IUPAC name is 2-methyl-3-(2-propylsulfonylethylsulfonyl)benzoic acid.
| Compound Name | 2-methyl-3-(2-propylsulfonylethylsulfonyl)benzoic acid |
|---|---|
| PubChem CID | 106726685 |
| Molecular Formula | C13H18O6S2 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.05 |
| IUPAC Name | 2-methyl-3-(2-propylsulfonylethylsulfonyl)benzoic acid |
| SMILES | CCCS(=O)(=O)CCS(=O)(=O)c1cccc(C(=O)O)c1C |
| InChI | InChI=1S/C13H18O6S2/c1-3-7-20(16,17)8-9-21(18,19)12-6-4-5-11(10(12)2)13(14)15/h4-6H,3,7-9H2,1-2H3,(H,14,15) |
| InChIKey | QGCSIVGQLCWOTF-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 105.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |