C13H15NO5S — CID 81444439
2-methyl-3-[2-oxo-2-(prop-2-enylamino)ethyl]sulfonylbenzoic acid (PubChem CID 81444439) has the molecular formula C13H15NO5S and a molecular weight of 297.33 g/mol. Its IUPAC name is 2-methyl-3-[2-oxo-2-(prop-2-enylamino)ethyl]sulfonylbenzoic acid.
| Compound Name | 2-methyl-3-[2-oxo-2-(prop-2-enylamino)ethyl]sulfonylbenzoic acid |
|---|---|
| PubChem CID | 81444439 |
| Molecular Formula | C13H15NO5S |
| Molecular Weight | 297.33 g/mol |
| Exact Mass | 297.07 |
| IUPAC Name | 2-methyl-3-[2-oxo-2-(prop-2-enylamino)ethyl]sulfonylbenzoic acid |
| SMILES | C=CCNC(=O)CS(=O)(=O)c1cccc(C(=O)O)c1C |
| InChI | InChI=1S/C13H15NO5S/c1-3-7-14-12(15)8-20(18,19)11-6-4-5-10(9(11)2)13(16)17/h3-6H,1,7-8H2,2H3,(H,14,15)(H,16,17) |
| InChIKey | FQKIWZOGMFANSG-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.33 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|