About 2-amino-2-phenylacetate;tetrabutylazanium
2-amino-2-phenylacetate;tetrabutylazanium (PubChem CID 141256319) has the molecular formula C24H44N2O2
and a molecular weight of 392.63 g/mol. Its IUPAC name is 2-amino-2-phenylacetate;tetrabutylazanium.
Molecular Properties
| Compound Name | 2-amino-2-phenylacetate;tetrabutylazanium |
| PubChem CID | 141256319 |
| Molecular Formula | C24H44N2O2 |
| Molecular Weight | 392.63 g/mol |
| Exact Mass | 392.34 |
| IUPAC Name | 2-amino-2-phenylacetate;tetrabutylazanium |
| SMILES | CCCC[N+](CCCC)(CCCC)CCCC.NC(C(=O)[O-])c1ccccc1 |
| InChI | InChI=1S/C16H36N.C8H9NO2/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;9-7(8(10)11)6-4-2-1-3-5-6/h5-16H2,1-4H3;1-5,7H,9H2,(H,10,11)/q+1;/p-1 |
| InChIKey | XYFFKTGQPMRIHI-UHFFFAOYSA-M |
| XLogP | 4.44 |
| TPSA | 66.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 392.63 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-2-phenylacetate;tetrabutylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-2-phenylacetate;tetrabutylazanium?
The IUPAC name of 2-amino-2-phenylacetate;tetrabutylazanium (CID 141256319) is 2-amino-2-phenylacetate;tetrabutylazanium.
What is the SMILES notation for 2-amino-2-phenylacetate;tetrabutylazanium?
The canonical SMILES for 2-amino-2-phenylacetate;tetrabutylazanium is CCCC[N+](CCCC)(CCCC)CCCC.NC(C(=O)[O-])c1ccccc1.
What is the InChIKey of 2-amino-2-phenylacetate;tetrabutylazanium?
The InChIKey is XYFFKTGQPMRIHI-UHFFFAOYSA-M. The full InChI is InChI=1S/C16H36N.C8H9NO2/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;9-7(8(10)11)6-4-2-1-3-5-6/h5-16H2,1-4H3;1-5,7H,9H2,(H,10,11)/q+1;/p-1.
What are the key properties of 2-amino-2-phenylacetate;tetrabutylazanium?
2-amino-2-phenylacetate;tetrabutylazanium has a molecular weight of 392.63 g/mol, XLogP of 4.44, 14 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-2-phenylacetate;tetrabutylazanium is sourced from PubChem (CID 141256319), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).