About fluoro(triphenyl)silane;tetrabutylazanium;fluoride
fluoro(triphenyl)silane;tetrabutylazanium;fluoride (PubChem CID 11027938) has the molecular formula C34H51F2NSi
and a molecular weight of 539.87 g/mol. Its IUPAC name is fluoro(triphenyl)silane;tetrabutylazanium;fluoride.
Molecular Properties
| Compound Name | fluoro(triphenyl)silane;tetrabutylazanium;fluoride |
| PubChem CID | 11027938 |
| Molecular Formula | C34H51F2NSi |
| Molecular Weight | 539.87 g/mol |
| Exact Mass | 539.38 |
| IUPAC Name | fluoro(triphenyl)silane;tetrabutylazanium;fluoride |
| SMILES | CCCC[N+](CCCC)(CCCC)CCCC.F[Si](c1ccccc1)(c1ccccc1)c1ccccc1.[F-] |
| InChI | InChI=1S/C18H15FSi.C16H36N.FH/c19-20(16-10-4-1-5-11-16,17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;/h1-15H;5-16H2,1-4H3;1H/q;+1;/p-1 |
| InChIKey | OLDCLLZUZBVXOM-UHFFFAOYSA-M |
| XLogP | 4.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 539.87 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze fluoro(triphenyl)silane;tetrabutylazanium;fluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of fluoro(triphenyl)silane;tetrabutylazanium;fluoride?
The IUPAC name of fluoro(triphenyl)silane;tetrabutylazanium;fluoride (CID 11027938) is fluoro(triphenyl)silane;tetrabutylazanium;fluoride.
What is the SMILES notation for fluoro(triphenyl)silane;tetrabutylazanium;fluoride?
The canonical SMILES for fluoro(triphenyl)silane;tetrabutylazanium;fluoride is CCCC[N+](CCCC)(CCCC)CCCC.F[Si](c1ccccc1)(c1ccccc1)c1ccccc1.[F-].
What is the InChIKey of fluoro(triphenyl)silane;tetrabutylazanium;fluoride?
The InChIKey is OLDCLLZUZBVXOM-UHFFFAOYSA-M. The full InChI is InChI=1S/C18H15FSi.C16H36N.FH/c19-20(16-10-4-1-5-11-16,17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;/h1-15H;5-16H2,1-4H3;1H/q;+1;/p-1.
What are the key properties of fluoro(triphenyl)silane;tetrabutylazanium;fluoride?
fluoro(triphenyl)silane;tetrabutylazanium;fluoride has a molecular weight of 539.87 g/mol, XLogP of 4.63, 15 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for fluoro(triphenyl)silane;tetrabutylazanium;fluoride is sourced from PubChem (CID 11027938), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).