About tetrabutylazanium;1,2-xylene
tetrabutylazanium;1,2-xylene (PubChem CID 69453766) has the molecular formula C24H46N+
and a molecular weight of 348.64 g/mol. Its IUPAC name is tetrabutylazanium;1,2-xylene.
Molecular Properties
| Compound Name | tetrabutylazanium;1,2-xylene |
| PubChem CID | 69453766 |
| Molecular Formula | C24H46N+ |
| Molecular Weight | 348.64 g/mol |
| Exact Mass | 348.36 |
| IUPAC Name | tetrabutylazanium;1,2-xylene |
| SMILES | CCCC[N+](CCCC)(CCCC)CCCC.Cc1ccccc1C |
| InChI | InChI=1S/C16H36N.C8H10/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;1-7-5-3-4-6-8(7)2/h5-16H2,1-4H3;3-6H,1-2H3/q+1; |
| InChIKey | JKNOWPFQMLFORR-UHFFFAOYSA-N |
| XLogP | 7.31 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 348.64 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze tetrabutylazanium;1,2-xylene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tetrabutylazanium;1,2-xylene?
The IUPAC name of tetrabutylazanium;1,2-xylene (CID 69453766) is tetrabutylazanium;1,2-xylene.
What is the SMILES notation for tetrabutylazanium;1,2-xylene?
The canonical SMILES for tetrabutylazanium;1,2-xylene is CCCC[N+](CCCC)(CCCC)CCCC.Cc1ccccc1C.
What is the InChIKey of tetrabutylazanium;1,2-xylene?
The InChIKey is JKNOWPFQMLFORR-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H36N.C8H10/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;1-7-5-3-4-6-8(7)2/h5-16H2,1-4H3;3-6H,1-2H3/q+1;.
What are the key properties of tetrabutylazanium;1,2-xylene?
tetrabutylazanium;1,2-xylene has a molecular weight of 348.64 g/mol, XLogP of 7.31, 12 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for tetrabutylazanium;1,2-xylene is sourced from PubChem (CID 69453766), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).