About chloronickel;2-(2-sulfidophenyl)sulfanylbenzenethiolate;tetrabutylazanium
chloronickel;2-(2-sulfidophenyl)sulfanylbenzenethiolate;tetrabutylazanium (PubChem CID 11273279) has the molecular formula C28H44ClNNiS3-
and a molecular weight of 585.01 g/mol. Its IUPAC name is chloronickel;2-(2-sulfidophenyl)sulfanylbenzenethiolate;tetrabutylazanium.
Molecular Properties
| Compound Name | chloronickel;2-(2-sulfidophenyl)sulfanylbenzenethiolate;tetrabutylazanium |
| PubChem CID | 11273279 |
| Molecular Formula | C28H44ClNNiS3- |
| Molecular Weight | 585.01 g/mol |
| Exact Mass | 583.17 |
| IUPAC Name | chloronickel;2-(2-sulfidophenyl)sulfanylbenzenethiolate;tetrabutylazanium |
| SMILES | CCCC[N+](CCCC)(CCCC)CCCC.Cl[Ni].[S-]c1ccccc1Sc1ccccc1[S-] |
| InChI | InChI=1S/C16H36N.C12H10S3.ClH.Ni/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;13-9-5-1-3-7-11(9)15-12-8-4-2-6-10(12)14;;/h5-16H2,1-4H3;1-8,13-14H;1H;/q+1;;;+1/p-3 |
| InChIKey | HJCOKBAPYZZZJF-UHFFFAOYSA-K |
| XLogP | 9.34 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 585.01 |
| LogP ≤ 5 | 9.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze chloronickel;2-(2-sulfidophenyl)sulfanylbenzenethiolate;tetrabutylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chloronickel;2-(2-sulfidophenyl)sulfanylbenzenethiolate;tetrabutylazanium?
The IUPAC name of chloronickel;2-(2-sulfidophenyl)sulfanylbenzenethiolate;tetrabutylazanium (CID 11273279) is chloronickel;2-(2-sulfidophenyl)sulfanylbenzenethiolate;tetrabutylazanium.
What is the SMILES notation for chloronickel;2-(2-sulfidophenyl)sulfanylbenzenethiolate;tetrabutylazanium?
The canonical SMILES for chloronickel;2-(2-sulfidophenyl)sulfanylbenzenethiolate;tetrabutylazanium is CCCC[N+](CCCC)(CCCC)CCCC.Cl[Ni].[S-]c1ccccc1Sc1ccccc1[S-].
What is the InChIKey of chloronickel;2-(2-sulfidophenyl)sulfanylbenzenethiolate;tetrabutylazanium?
The InChIKey is HJCOKBAPYZZZJF-UHFFFAOYSA-K. The full InChI is InChI=1S/C16H36N.C12H10S3.ClH.Ni/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;13-9-5-1-3-7-11(9)15-12-8-4-2-6-10(12)14;;/h5-16H2,1-4H3;1-8,13-14H;1H;/q+1;;;+1/p-3.
What are the key properties of chloronickel;2-(2-sulfidophenyl)sulfanylbenzenethiolate;tetrabutylazanium?
chloronickel;2-(2-sulfidophenyl)sulfanylbenzenethiolate;tetrabutylazanium has a molecular weight of 585.01 g/mol, XLogP of 9.34, 14 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for chloronickel;2-(2-sulfidophenyl)sulfanylbenzenethiolate;tetrabutylazanium is sourced from PubChem (CID 11273279), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).