C34H72N6S2 — CID 54762057
bis(tetrabutylazanium);1,2,4,5-tetrazine-3,6-dithiolate (PubChem CID 54762057) has the molecular formula C34H72N6S2 and a molecular weight of 629.13 g/mol. Its IUPAC name is bis(tetrabutylazanium);1,2,4,5-tetrazine-3,6-dithiolate.
| Compound Name | bis(tetrabutylazanium);1,2,4,5-tetrazine-3,6-dithiolate |
|---|---|
| PubChem CID | 54762057 |
| Molecular Formula | C34H72N6S2 |
| Molecular Weight | 629.13 g/mol |
| Exact Mass | 628.53 |
| IUPAC Name | bis(tetrabutylazanium);1,2,4,5-tetrazine-3,6-dithiolate |
| SMILES | CCCC[N+](CCCC)(CCCC)CCCC.CCCC[N+](CCCC)(CCCC)CCCC.[S-]c1nnc([S-])nn1 |
| InChI | InChI=1S/2C16H36N.C2H2N4S2/c2*1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;7-1-3-5-2(8)6-4-1/h2*5-16H2,1-4H3;(H,3,4,7)(H,5,6,8)/q2*+1;/p-2 |
| InChIKey | CJDWFWDYKQQXHE-UHFFFAOYSA-L |
| XLogP | 9.09 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.13 |
| LogP ≤ 5 | 9.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|