About tetrabutylazanium;trimethyl(sulfido)silane
tetrabutylazanium;trimethyl(sulfido)silane (PubChem CID 88876786) has the molecular formula C19H45NSSi
and a molecular weight of 347.73 g/mol. Its IUPAC name is tetrabutylazanium;trimethyl(sulfido)silane.
Molecular Properties
| Compound Name | tetrabutylazanium;trimethyl(sulfido)silane |
| PubChem CID | 88876786 |
| Molecular Formula | C19H45NSSi |
| Molecular Weight | 347.73 g/mol |
| Exact Mass | 347.30 |
| IUPAC Name | tetrabutylazanium;trimethyl(sulfido)silane |
| SMILES | CCCC[N+](CCCC)(CCCC)CCCC.C[Si](C)(C)[S-] |
| InChI | InChI=1S/C16H36N.C3H9SSi/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;1-5(2,3)4/h5-16H2,1-4H3;1-3H3/q+1;-1 |
| InChIKey | VAVNXJDQDUZPTH-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 347.73 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze tetrabutylazanium;trimethyl(sulfido)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tetrabutylazanium;trimethyl(sulfido)silane?
The IUPAC name of tetrabutylazanium;trimethyl(sulfido)silane (CID 88876786) is tetrabutylazanium;trimethyl(sulfido)silane.
What is the SMILES notation for tetrabutylazanium;trimethyl(sulfido)silane?
The canonical SMILES for tetrabutylazanium;trimethyl(sulfido)silane is CCCC[N+](CCCC)(CCCC)CCCC.C[Si](C)(C)[S-].
What is the InChIKey of tetrabutylazanium;trimethyl(sulfido)silane?
The InChIKey is VAVNXJDQDUZPTH-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H36N.C3H9SSi/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;1-5(2,3)4/h5-16H2,1-4H3;1-3H3/q+1;-1.
What are the key properties of tetrabutylazanium;trimethyl(sulfido)silane?
tetrabutylazanium;trimethyl(sulfido)silane has a molecular weight of 347.73 g/mol, XLogP of 6.37, 12 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for tetrabutylazanium;trimethyl(sulfido)silane is sourced from PubChem (CID 88876786), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).