About copper dioxido-oxo-phenyl-λ5-phosphane
copper dioxido-oxo-phenyl-λ5-phosphane (PubChem CID 68627267) has the molecular formula C6H5CuO3P
and a molecular weight of 219.62 g/mol. Its IUPAC name is copper dioxido-oxo-phenyl-λ5-phosphane.
Molecular Properties
| Compound Name | copper dioxido-oxo-phenyl-λ5-phosphane |
| PubChem CID | 68627267 |
| Molecular Formula | C6H5CuO3P |
| Molecular Weight | 219.62 g/mol |
| Exact Mass | 218.93 |
| IUPAC Name | copper dioxido-oxo-phenyl-λ5-phosphane |
| SMILES | O=P([O-])([O-])c1ccccc1.[Cu+2] |
| InChI | InChI=1S/C6H7O3P.Cu/c7-10(8,9)6-4-2-1-3-5-6;/h1-5H,(H2,7,8,9);/q;+2/p-2 |
| InChIKey | DHGSSULXZRNIPW-UHFFFAOYSA-L |
| XLogP | -0.78 |
| TPSA | 63.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.62 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze copper dioxido-oxo-phenyl-λ5-phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of copper dioxido-oxo-phenyl-λ5-phosphane?
The IUPAC name of copper dioxido-oxo-phenyl-λ5-phosphane (CID 68627267) is copper dioxido-oxo-phenyl-λ5-phosphane.
What is the SMILES notation for copper dioxido-oxo-phenyl-λ5-phosphane?
The canonical SMILES for copper dioxido-oxo-phenyl-λ5-phosphane is O=P([O-])([O-])c1ccccc1.[Cu+2].
What is the InChIKey of copper dioxido-oxo-phenyl-λ5-phosphane?
The InChIKey is DHGSSULXZRNIPW-UHFFFAOYSA-L. The full InChI is InChI=1S/C6H7O3P.Cu/c7-10(8,9)6-4-2-1-3-5-6;/h1-5H,(H2,7,8,9);/q;+2/p-2.
What are the key properties of copper dioxido-oxo-phenyl-λ5-phosphane?
copper dioxido-oxo-phenyl-λ5-phosphane has a molecular weight of 219.62 g/mol, XLogP of -0.78, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for copper dioxido-oxo-phenyl-λ5-phosphane is sourced from PubChem (CID 68627267), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).