C31H35N2O3P — CID 11455079
(1R,2S)-N,N',N'-tribenzyl-2-dimethoxyphosphoryl-1-phenylethane-1,2-diamine (PubChem CID 11455079) has the molecular formula C31H35N2O3P and a molecular weight of 514.61 g/mol. Its IUPAC name is (1R,2S)-N,N',N'-tribenzyl-2-dimethoxyphosphoryl-1-phenylethane-1,2-diamine.
| Compound Name | (1R,2S)-N,N',N'-tribenzyl-2-dimethoxyphosphoryl-1-phenylethane-1,2-diamine |
|---|---|
| PubChem CID | 11455079 |
| Molecular Formula | C31H35N2O3P |
| Molecular Weight | 514.61 g/mol |
| Exact Mass | 514.24 |
| IUPAC Name | (1R,2S)-N,N',N'-tribenzyl-2-dimethoxyphosphoryl-1-phenylethane-1,2-diamine |
| SMILES | COP(=O)(OC)[C@@H]([C@H](NCc1ccccc1)c1ccccc1)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C31H35N2O3P/c1-35-37(34,36-2)31(30(29-21-13-6-14-22-29)32-23-26-15-7-3-8-16-26)33(24-27-17-9-4-10-18-27)25-28-19-11-5-12-20-28/h3-22,30-32H,23-25H2,1-2H3/t30-,31+/m1/s1 |
| InChIKey | DXMMTLFZVMYQFI-JSOSNVBQSA-N |
| XLogP | 7.03 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.61 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|