C25H28NO2P — CID 132551525
2-[(diphenylphosphorylamino)-(3-methylphenyl)methyl]-3-methylbut-3-en-1-ol (PubChem CID 132551525) has the molecular formula C25H28NO2P and a molecular weight of 405.48 g/mol. Its IUPAC name is 2-[(diphenylphosphorylamino)-(3-methylphenyl)methyl]-3-methylbut-3-en-1-ol.
| Compound Name | 2-[(diphenylphosphorylamino)-(3-methylphenyl)methyl]-3-methylbut-3-en-1-ol |
|---|---|
| PubChem CID | 132551525 |
| Molecular Formula | C25H28NO2P |
| Molecular Weight | 405.48 g/mol |
| Exact Mass | 405.19 |
| IUPAC Name | 2-[(diphenylphosphorylamino)-(3-methylphenyl)methyl]-3-methylbut-3-en-1-ol |
| SMILES | C=C(C)C(CO)C(NP(=O)(c1ccccc1)c1ccccc1)c1cccc(C)c1 |
| InChI | InChI=1S/C25H28NO2P/c1-19(2)24(18-27)25(21-12-10-11-20(3)17-21)26-29(28,22-13-6-4-7-14-22)23-15-8-5-9-16-23/h4-17,24-25,27H,1,18H2,2-3H3,(H,26,28) |
| InChIKey | WIZSYVPWPDLCJN-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.48 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|