C23H21ClNO2PS — CID 23643726
methyl 2-[(2-chlorophenyl)-(diphenylphosphinothioylamino)methyl]prop-2-enoate (PubChem CID 23643726) has the molecular formula C23H21ClNO2PS and a molecular weight of 441.92 g/mol. Its IUPAC name is methyl 2-[(2-chlorophenyl)-(diphenylphosphinothioylamino)methyl]prop-2-enoate.
| Compound Name | methyl 2-[(2-chlorophenyl)-(diphenylphosphinothioylamino)methyl]prop-2-enoate |
|---|---|
| PubChem CID | 23643726 |
| Molecular Formula | C23H21ClNO2PS |
| Molecular Weight | 441.92 g/mol |
| Exact Mass | 441.07 |
| IUPAC Name | methyl 2-[(2-chlorophenyl)-(diphenylphosphinothioylamino)methyl]prop-2-enoate |
| SMILES | C=C(C(=O)OC)C(NP(=S)(c1ccccc1)c1ccccc1)c1ccccc1Cl |
| InChI | InChI=1S/C23H21ClNO2PS/c1-17(23(26)27-2)22(20-15-9-10-16-21(20)24)25-28(29,18-11-5-3-6-12-18)19-13-7-4-8-14-19/h3-16,22H,1H2,2H3,(H,25,29) |
| InChIKey | ZGFBGXKASGERLZ-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.92 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|