C19H14ClNO4 — CID 102591556
methyl 2-[(S)-(2-chlorophenyl)-(2,3-dioxoindol-1-yl)methyl]prop-2-enoate (PubChem CID 102591556) has the molecular formula C19H14ClNO4 and a molecular weight of 355.78 g/mol. Its IUPAC name is methyl 2-[(S)-(2-chlorophenyl)-(2,3-dioxoindol-1-yl)methyl]prop-2-enoate.
| Compound Name | methyl 2-[(S)-(2-chlorophenyl)-(2,3-dioxoindol-1-yl)methyl]prop-2-enoate |
|---|---|
| PubChem CID | 102591556 |
| Molecular Formula | C19H14ClNO4 |
| Molecular Weight | 355.78 g/mol |
| Exact Mass | 355.06 |
| IUPAC Name | methyl 2-[(S)-(2-chlorophenyl)-(2,3-dioxoindol-1-yl)methyl]prop-2-enoate |
| SMILES | C=C(C(=O)OC)[C@@H](c1ccccc1Cl)N1C(=O)C(=O)c2ccccc21 |
| InChI | InChI=1S/C19H14ClNO4/c1-11(19(24)25-2)16(12-7-3-5-9-14(12)20)21-15-10-6-4-8-13(15)17(22)18(21)23/h3-10,16H,1H2,2H3/t16-/m0/s1 |
| InChIKey | RBSRNJVNYHOBTI-INIZCTEOSA-N |
| XLogP | 3.34 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.78 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|