C20H20O7 — CID 175024375
3-benzoyl-2,3,4,5-tetrahydroxy-2-methyl-6-oxo-6-phenylhexanal (PubChem CID 175024375) has the molecular formula C20H20O7 and a molecular weight of 372.37 g/mol. Its IUPAC name is 3-benzoyl-2,3,4,5-tetrahydroxy-2-methyl-6-oxo-6-phenylhexanal.
| Compound Name | 3-benzoyl-2,3,4,5-tetrahydroxy-2-methyl-6-oxo-6-phenylhexanal |
|---|---|
| PubChem CID | 175024375 |
| Molecular Formula | C20H20O7 |
| Molecular Weight | 372.37 g/mol |
| Exact Mass | 372.12 |
| IUPAC Name | 3-benzoyl-2,3,4,5-tetrahydroxy-2-methyl-6-oxo-6-phenylhexanal |
| SMILES | CC(O)(C=O)C(O)(C(=O)c1ccccc1)C(O)C(O)C(=O)c1ccccc1 |
| InChI | InChI=1S/C20H20O7/c1-19(26,12-21)20(27,17(24)14-10-6-3-7-11-14)18(25)16(23)15(22)13-8-4-2-5-9-13/h2-12,16,18,23,25-27H,1H3 |
| InChIKey | IZRHDSFLPBFRTR-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 132.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.37 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|