C22H21NO3 — CID 12754751
(3R,4R)-1-naphthalen-1-yl-4-nitro-3-phenylhexan-1-one (PubChem CID 12754751) has the molecular formula C22H21NO3 and a molecular weight of 347.41 g/mol. Its IUPAC name is (3R,4R)-1-naphthalen-1-yl-4-nitro-3-phenylhexan-1-one.
| Compound Name | (3R,4R)-1-naphthalen-1-yl-4-nitro-3-phenylhexan-1-one |
|---|---|
| PubChem CID | 12754751 |
| Molecular Formula | C22H21NO3 |
| Molecular Weight | 347.41 g/mol |
| Exact Mass | 347.15 |
| IUPAC Name | (3R,4R)-1-naphthalen-1-yl-4-nitro-3-phenylhexan-1-one |
| SMILES | CC[C@H]([C@H](CC(=O)c1cccc2ccccc12)c1ccccc1)[N+](=O)[O-] |
| InChI | InChI=1S/C22H21NO3/c1-2-21(23(25)26)20(17-9-4-3-5-10-17)15-22(24)19-14-8-12-16-11-6-7-13-18(16)19/h3-14,20-21H,2,15H2,1H3/t20-,21-/m1/s1 |
| InChIKey | VLTNWKOEXVBHIN-NHCUHLMSSA-N |
| XLogP | 5.25 |
| TPSA | 60.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.41 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|