About 4-[(2Z,7Z)-nona-2,7-dien-5-yl]pyridine
4-[(2Z,7Z)-nona-2,7-dien-5-yl]pyridine (PubChem CID 6000004) has the molecular formula C14H19N
and a molecular weight of 201.31 g/mol. Its IUPAC name is 4-[(2Z,7Z)-nona-2,7-dien-5-yl]pyridine.
Molecular Properties
| Compound Name | 4-[(2Z,7Z)-nona-2,7-dien-5-yl]pyridine |
| PubChem CID | 6000004 |
| Molecular Formula | C14H19N |
| Molecular Weight | 201.31 g/mol |
| Exact Mass | 201.15 |
| IUPAC Name | 4-[(2Z,7Z)-nona-2,7-dien-5-yl]pyridine |
| SMILES | C/C=C\CC(C/C=C\C)c1ccncc1 |
| InChI | InChI=1S/C14H19N/c1-3-5-7-13(8-6-4-2)14-9-11-15-12-10-14/h3-6,9-13H,7-8H2,1-2H3/b5-3-,6-4- |
| InChIKey | ABNCIWHCOXTEEZ-GLIMQPGKSA-N |
| XLogP | 4.10 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.31 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-[(2Z,7Z)-nona-2,7-dien-5-yl]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(2Z,7Z)-nona-2,7-dien-5-yl]pyridine?
The IUPAC name of 4-[(2Z,7Z)-nona-2,7-dien-5-yl]pyridine (CID 6000004) is 4-[(2Z,7Z)-nona-2,7-dien-5-yl]pyridine.
What is the SMILES notation for 4-[(2Z,7Z)-nona-2,7-dien-5-yl]pyridine?
The canonical SMILES for 4-[(2Z,7Z)-nona-2,7-dien-5-yl]pyridine is C/C=C\CC(C/C=C\C)c1ccncc1.
What is the InChIKey of 4-[(2Z,7Z)-nona-2,7-dien-5-yl]pyridine?
The InChIKey is ABNCIWHCOXTEEZ-GLIMQPGKSA-N. The full InChI is InChI=1S/C14H19N/c1-3-5-7-13(8-6-4-2)14-9-11-15-12-10-14/h3-6,9-13H,7-8H2,1-2H3/b5-3-,6-4-.
What are the key properties of 4-[(2Z,7Z)-nona-2,7-dien-5-yl]pyridine?
4-[(2Z,7Z)-nona-2,7-dien-5-yl]pyridine has a molecular weight of 201.31 g/mol, XLogP of 4.10, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2Z,7Z)-nona-2,7-dien-5-yl]pyridine is sourced from PubChem (CID 6000004), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).