C25H32N2O4 — CID 135065775
methyl (2S,3R)-2-(benzhydrylideneamino)-4-methyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate (PubChem CID 135065775) has the molecular formula C25H32N2O4 and a molecular weight of 424.54 g/mol. Its IUPAC name is methyl (2S,3R)-2-(benzhydrylideneamino)-4-methyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate.
| Compound Name | methyl (2S,3R)-2-(benzhydrylideneamino)-4-methyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate |
|---|---|
| PubChem CID | 135065775 |
| Molecular Formula | C25H32N2O4 |
| Molecular Weight | 424.54 g/mol |
| Exact Mass | 424.24 |
| IUPAC Name | methyl (2S,3R)-2-(benzhydrylideneamino)-4-methyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate |
| SMILES | COC(=O)[C@@H](N=C(c1ccccc1)c1ccccc1)[C@H](NC(=O)OC(C)(C)C)C(C)C |
| InChI | InChI=1S/C25H32N2O4/c1-17(2)20(27-24(29)31-25(3,4)5)22(23(28)30-6)26-21(18-13-9-7-10-14-18)19-15-11-8-12-16-19/h7-17,20,22H,1-6H3,(H,27,29)/t20-,22+/m1/s1 |
| InChIKey | VPXPWJMYIPOQLG-IRLDBZIGSA-N |
| XLogP | 4.61 |
| TPSA | 76.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.54 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|