C32H32N2O4 — CID 102173114
methyl (2R,3S)-2-(benzhydrylideneamino)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-3-naphthalen-1-ylpropanoate (PubChem CID 102173114) has the molecular formula C32H32N2O4 and a molecular weight of 508.62 g/mol. Its IUPAC name is methyl (2R,3S)-2-(benzhydrylideneamino)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-3-naphthalen-1-ylpropanoate.
| Compound Name | methyl (2R,3S)-2-(benzhydrylideneamino)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-3-naphthalen-1-ylpropanoate |
|---|---|
| PubChem CID | 102173114 |
| Molecular Formula | C32H32N2O4 |
| Molecular Weight | 508.62 g/mol |
| Exact Mass | 508.24 |
| IUPAC Name | methyl (2R,3S)-2-(benzhydrylideneamino)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-3-naphthalen-1-ylpropanoate |
| SMILES | COC(=O)[C@H](N=C(c1ccccc1)c1ccccc1)[C@@H](NC(=O)OC(C)(C)C)c1cccc2ccccc12 |
| InChI | InChI=1S/C32H32N2O4/c1-32(2,3)38-31(36)34-28(26-21-13-19-22-14-11-12-20-25(22)26)29(30(35)37-4)33-27(23-15-7-5-8-16-23)24-17-9-6-10-18-24/h5-21,28-29H,1-4H3,(H,34,36)/t28-,29+/m0/s1 |
| InChIKey | QKCVMEOAZQIADP-URLMMPGGSA-N |
| XLogP | 6.48 |
| TPSA | 76.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.62 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|