C28H29BrN2O4 — CID 102173113
methyl (2R,3S)-2-(benzhydrylideneamino)-3-(4-bromophenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate (PubChem CID 102173113) has the molecular formula C28H29BrN2O4 and a molecular weight of 537.45 g/mol. Its IUPAC name is methyl (2R,3S)-2-(benzhydrylideneamino)-3-(4-bromophenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate.
| Compound Name | methyl (2R,3S)-2-(benzhydrylideneamino)-3-(4-bromophenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
|---|---|
| PubChem CID | 102173113 |
| Molecular Formula | C28H29BrN2O4 |
| Molecular Weight | 537.45 g/mol |
| Exact Mass | 536.13 |
| IUPAC Name | methyl (2R,3S)-2-(benzhydrylideneamino)-3-(4-bromophenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
| SMILES | COC(=O)[C@H](N=C(c1ccccc1)c1ccccc1)[C@@H](NC(=O)OC(C)(C)C)c1ccc(Br)cc1 |
| InChI | InChI=1S/C28H29BrN2O4/c1-28(2,3)35-27(33)31-24(21-15-17-22(29)18-16-21)25(26(32)34-4)30-23(19-11-7-5-8-12-19)20-13-9-6-10-14-20/h5-18,24-25H,1-4H3,(H,31,33)/t24-,25+/m0/s1 |
| InChIKey | PYQNBTZSKPALFB-LOSJGSFVSA-N |
| XLogP | 6.09 |
| TPSA | 76.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.45 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|