C29H25ClN2O2 — CID 27001668
methyl (2R,3S)-2-(benzhydrylideneamino)-3-(4-chloroanilino)-3-phenylpropanoate (PubChem CID 27001668) has the molecular formula C29H25ClN2O2 and a molecular weight of 468.98 g/mol. Its IUPAC name is methyl (2R,3S)-2-(benzhydrylideneamino)-3-(4-chloroanilino)-3-phenylpropanoate.
| Compound Name | methyl (2R,3S)-2-(benzhydrylideneamino)-3-(4-chloroanilino)-3-phenylpropanoate |
|---|---|
| PubChem CID | 27001668 |
| Molecular Formula | C29H25ClN2O2 |
| Molecular Weight | 468.98 g/mol |
| Exact Mass | 468.16 |
| IUPAC Name | methyl (2R,3S)-2-(benzhydrylideneamino)-3-(4-chloroanilino)-3-phenylpropanoate |
| SMILES | COC(=O)[C@H](N=C(c1ccccc1)c1ccccc1)[C@@H](Nc1ccc(Cl)cc1)c1ccccc1 |
| InChI | InChI=1S/C29H25ClN2O2/c1-34-29(33)28(32-26(21-11-5-2-6-12-21)22-13-7-3-8-14-22)27(23-15-9-4-10-16-23)31-25-19-17-24(30)18-20-25/h2-20,27-28,31H,1H3/t27-,28+/m0/s1 |
| InChIKey | JLWPHRZIVVZZJI-WUFINQPMSA-N |
| XLogP | 6.57 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.98 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|