C33H27ClN2 — CID 27153311
N-[(1S,2S)-2-(benzhydrylideneamino)-1-(4-chlorophenyl)-2-phenylethyl]aniline (PubChem CID 27153311) has the molecular formula C33H27ClN2 and a molecular weight of 487.05 g/mol. Its IUPAC name is N-[(1S,2S)-2-(benzhydrylideneamino)-1-(4-chlorophenyl)-2-phenylethyl]aniline.
| Compound Name | N-[(1S,2S)-2-(benzhydrylideneamino)-1-(4-chlorophenyl)-2-phenylethyl]aniline |
|---|---|
| PubChem CID | 27153311 |
| Molecular Formula | C33H27ClN2 |
| Molecular Weight | 487.05 g/mol |
| Exact Mass | 486.19 |
| IUPAC Name | N-[(1S,2S)-2-(benzhydrylideneamino)-1-(4-chlorophenyl)-2-phenylethyl]aniline |
| SMILES | Clc1ccc([C@H](Nc2ccccc2)[C@@H](N=C(c2ccccc2)c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C33H27ClN2/c34-29-23-21-28(22-24-29)32(35-30-19-11-4-12-20-30)33(27-17-9-3-10-18-27)36-31(25-13-5-1-6-14-25)26-15-7-2-8-16-26/h1-24,32-33,35H/t32-,33-/m0/s1 |
| InChIKey | DWXJOKZTKCSZDM-LQJZCPKCSA-N |
| XLogP | 8.77 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.05 |
| LogP ≤ 5 | 8.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|