C29H25N3 — CID 40549544
(2R,3R)-3-anilino-2-(benzhydrylideneamino)-3-(4-methylphenyl)propanenitrile (PubChem CID 40549544) has the molecular formula C29H25N3 and a molecular weight of 415.54 g/mol. Its IUPAC name is (2R,3R)-3-anilino-2-(benzhydrylideneamino)-3-(4-methylphenyl)propanenitrile.
| Compound Name | (2R,3R)-3-anilino-2-(benzhydrylideneamino)-3-(4-methylphenyl)propanenitrile |
|---|---|
| PubChem CID | 40549544 |
| Molecular Formula | C29H25N3 |
| Molecular Weight | 415.54 g/mol |
| Exact Mass | 415.20 |
| IUPAC Name | (2R,3R)-3-anilino-2-(benzhydrylideneamino)-3-(4-methylphenyl)propanenitrile |
| SMILES | Cc1ccc([C@@H](Nc2ccccc2)[C@H](C#N)N=C(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C29H25N3/c1-22-17-19-25(20-18-22)29(31-26-15-9-4-10-16-26)27(21-30)32-28(23-11-5-2-6-12-23)24-13-7-3-8-14-24/h2-20,27,29,31H,1H3/t27-,29+/m0/s1 |
| InChIKey | KUYZSVXYXUNGMC-LMSSTIIKSA-N |
| XLogP | 6.58 |
| TPSA | 48.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.54 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|