C31H34N2O4 — CID 58202499
tert-butyl 2-(fluoren-9-ylideneamino)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropanoate (PubChem CID 58202499) has the molecular formula C31H34N2O4 and a molecular weight of 498.62 g/mol. Its IUPAC name is tert-butyl 2-(fluoren-9-ylideneamino)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropanoate.
| Compound Name | tert-butyl 2-(fluoren-9-ylideneamino)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 58202499 |
| Molecular Formula | C31H34N2O4 |
| Molecular Weight | 498.62 g/mol |
| Exact Mass | 498.25 |
| IUPAC Name | tert-butyl 2-(fluoren-9-ylideneamino)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropanoate |
| SMILES | CC(C)(C)OC(=O)NC(c1ccccc1)C(N=C1c2ccccc2-c2ccccc21)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C31H34N2O4/c1-30(2,3)36-28(34)27(25(20-14-8-7-9-15-20)33-29(35)37-31(4,5)6)32-26-23-18-12-10-16-21(23)22-17-11-13-19-24(22)26/h7-19,25,27H,1-6H3,(H,33,35) |
| InChIKey | MVXGXZOAZBVRCX-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 76.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.62 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|