C27H28N2O4P+ — CID 58202513
[(1S,2S)-1-(fluoren-9-ylideneamino)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-2-phenylethyl]-methoxy-oxophosphanium (PubChem CID 58202513) has the molecular formula C27H28N2O4P+ and a molecular weight of 475.51 g/mol. Its IUPAC name is [(1S,2S)-1-(fluoren-9-ylideneamino)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-2-phenylethyl]-methoxy-oxophosphanium.
| Compound Name | [(1S,2S)-1-(fluoren-9-ylideneamino)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-2-phenylethyl]-methoxy-oxophosphanium |
|---|---|
| PubChem CID | 58202513 |
| Molecular Formula | C27H28N2O4P+ |
| Molecular Weight | 475.51 g/mol |
| Exact Mass | 475.18 |
| IUPAC Name | [(1S,2S)-1-(fluoren-9-ylideneamino)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-2-phenylethyl]-methoxy-oxophosphanium |
| SMILES | CO[P+](=O)[C@H](N=C1c2ccccc2-c2ccccc21)[C@@H](NC(=O)OC(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C27H27N2O4P/c1-27(2,3)33-26(30)29-23(18-12-6-5-7-13-18)25(34(31)32-4)28-24-21-16-10-8-14-19(21)20-15-9-11-17-22(20)24/h5-17,23,25H,1-4H3/p+1/t23-,25-/m0/s1 |
| InChIKey | SXESAIUUXAIUAZ-ZCYQVOJMSA-O |
| XLogP | 6.49 |
| TPSA | 76.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.51 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|