C25H26N2O2S — CID 143862681
tert-butyl N-[2-(fluoren-9-ylideneamino)-1-thiophen-2-ylpropyl]carbamate (PubChem CID 143862681) has the molecular formula C25H26N2O2S and a molecular weight of 418.56 g/mol. Its IUPAC name is tert-butyl N-[2-(fluoren-9-ylideneamino)-1-thiophen-2-ylpropyl]carbamate.
| Compound Name | tert-butyl N-[2-(fluoren-9-ylideneamino)-1-thiophen-2-ylpropyl]carbamate |
|---|---|
| PubChem CID | 143862681 |
| Molecular Formula | C25H26N2O2S |
| Molecular Weight | 418.56 g/mol |
| Exact Mass | 418.17 |
| IUPAC Name | tert-butyl N-[2-(fluoren-9-ylideneamino)-1-thiophen-2-ylpropyl]carbamate |
| SMILES | CC(N=C1c2ccccc2-c2ccccc21)C(NC(=O)OC(C)(C)C)c1cccs1 |
| InChI | InChI=1S/C25H26N2O2S/c1-16(22(21-14-9-15-30-21)27-24(28)29-25(2,3)4)26-23-19-12-7-5-10-17(19)18-11-6-8-13-20(18)23/h5-16,22H,1-4H3,(H,27,28) |
| InChIKey | IRFYWUBFQMNAGM-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.56 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|