C30H37N2O5PS — CID 123201172
tert-butyl N-[2-di(propan-2-yloxy)phosphoryl-2-(9H-fluoren-9-ylimino)-1-thiophen-2-ylethyl]carbamate (PubChem CID 123201172) has the molecular formula C30H37N2O5PS and a molecular weight of 568.68 g/mol. Its IUPAC name is tert-butyl N-[2-di(propan-2-yloxy)phosphoryl-2-(9H-fluoren-9-ylimino)-1-thiophen-2-ylethyl]carbamate.
| Compound Name | tert-butyl N-[2-di(propan-2-yloxy)phosphoryl-2-(9H-fluoren-9-ylimino)-1-thiophen-2-ylethyl]carbamate |
|---|---|
| PubChem CID | 123201172 |
| Molecular Formula | C30H37N2O5PS |
| Molecular Weight | 568.68 g/mol |
| Exact Mass | 568.22 |
| IUPAC Name | tert-butyl N-[2-di(propan-2-yloxy)phosphoryl-2-(9H-fluoren-9-ylimino)-1-thiophen-2-ylethyl]carbamate |
| SMILES | CC(C)OP(=O)(OC(C)C)/C(=N\C1c2ccccc2-c2ccccc21)C(NC(=O)OC(C)(C)C)c1cccs1 |
| InChI | InChI=1S/C30H37N2O5PS/c1-19(2)36-38(34,37-20(3)4)28(27(25-17-12-18-39-25)32-29(33)35-30(5,6)7)31-26-23-15-10-8-13-21(23)22-14-9-11-16-24(22)26/h8-20,26-27H,1-7H3,(H,32,33)/b31-28- |
| InChIKey | NOSBOSBDSBULII-PNOGMODKSA-N |
| XLogP | 8.53 |
| TPSA | 86.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.68 |
| LogP ≤ 5 | 8.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|