About propan-2-yl (E)-2-(benzhydrylideneamino)-5-oxo-5-phenylpent-2-enoate
propan-2-yl (E)-2-(benzhydrylideneamino)-5-oxo-5-phenylpent-2-enoate (PubChem CID 102411256) has the molecular formula C27H25NO3
and a molecular weight of 411.50 g/mol. Its IUPAC name is propan-2-yl (E)-2-(benzhydrylideneamino)-5-oxo-5-phenylpent-2-enoate.
Molecular Properties
| Compound Name | propan-2-yl (E)-2-(benzhydrylideneamino)-5-oxo-5-phenylpent-2-enoate |
| PubChem CID | 102411256 |
| Molecular Formula | C27H25NO3 |
| Molecular Weight | 411.50 g/mol |
| Exact Mass | 411.18 |
| IUPAC Name | propan-2-yl (E)-2-(benzhydrylideneamino)-5-oxo-5-phenylpent-2-enoate |
| SMILES | CC(C)OC(=O)/C(=C\CC(=O)c1ccccc1)N=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H25NO3/c1-20(2)31-27(30)24(18-19-25(29)21-12-6-3-7-13-21)28-26(22-14-8-4-9-15-22)23-16-10-5-11-17-23/h3-18,20H,19H2,1-2H3/b24-18+ |
| InChIKey | UEQSEEHISKYJEN-HKOYGPOVSA-N |
| XLogP | 5.63 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 411.50 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze propan-2-yl (E)-2-(benzhydrylideneamino)-5-oxo-5-phenylpent-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-yl (E)-2-(benzhydrylideneamino)-5-oxo-5-phenylpent-2-enoate?
The IUPAC name of propan-2-yl (E)-2-(benzhydrylideneamino)-5-oxo-5-phenylpent-2-enoate (CID 102411256) is propan-2-yl (E)-2-(benzhydrylideneamino)-5-oxo-5-phenylpent-2-enoate.
What is the SMILES notation for propan-2-yl (E)-2-(benzhydrylideneamino)-5-oxo-5-phenylpent-2-enoate?
The canonical SMILES for propan-2-yl (E)-2-(benzhydrylideneamino)-5-oxo-5-phenylpent-2-enoate is CC(C)OC(=O)/C(=C\CC(=O)c1ccccc1)N=C(c1ccccc1)c1ccccc1.
What is the InChIKey of propan-2-yl (E)-2-(benzhydrylideneamino)-5-oxo-5-phenylpent-2-enoate?
The InChIKey is UEQSEEHISKYJEN-HKOYGPOVSA-N. The full InChI is InChI=1S/C27H25NO3/c1-20(2)31-27(30)24(18-19-25(29)21-12-6-3-7-13-21)28-26(22-14-8-4-9-15-22)23-16-10-5-11-17-23/h3-18,20H,19H2,1-2H3/b24-18+.
What are the key properties of propan-2-yl (E)-2-(benzhydrylideneamino)-5-oxo-5-phenylpent-2-enoate?
propan-2-yl (E)-2-(benzhydrylideneamino)-5-oxo-5-phenylpent-2-enoate has a molecular weight of 411.50 g/mol, XLogP of 5.63, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl (E)-2-(benzhydrylideneamino)-5-oxo-5-phenylpent-2-enoate is sourced from PubChem (CID 102411256), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).