About ethane;propan-2-yl (NZ)-N-(1-phenylpropylidene)carbamate
ethane;propan-2-yl (NZ)-N-(1-phenylpropylidene)carbamate (PubChem CID 142227813) has the molecular formula C15H23NO2
and a molecular weight of 249.35 g/mol. Its IUPAC name is ethane;propan-2-yl (NZ)-N-(1-phenylpropylidene)carbamate.
Molecular Properties
| Compound Name | ethane;propan-2-yl (NZ)-N-(1-phenylpropylidene)carbamate |
| PubChem CID | 142227813 |
| Molecular Formula | C15H23NO2 |
| Molecular Weight | 249.35 g/mol |
| Exact Mass | 249.17 |
| IUPAC Name | ethane;propan-2-yl (NZ)-N-(1-phenylpropylidene)carbamate |
| SMILES | CC.CC/C(=N/C(=O)OC(C)C)c1ccccc1 |
| InChI | InChI=1S/C13H17NO2.C2H6/c1-4-12(11-8-6-5-7-9-11)14-13(15)16-10(2)3;1-2/h5-10H,4H2,1-3H3;1-2H3/b14-12-; |
| InChIKey | BHFVQVFPRNDKIP-CTMPBGLUSA-N |
| XLogP | 4.46 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.35 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze ethane;propan-2-yl (NZ)-N-(1-phenylpropylidene)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;propan-2-yl (NZ)-N-(1-phenylpropylidene)carbamate?
The IUPAC name of ethane;propan-2-yl (NZ)-N-(1-phenylpropylidene)carbamate (CID 142227813) is ethane;propan-2-yl (NZ)-N-(1-phenylpropylidene)carbamate.
What is the SMILES notation for ethane;propan-2-yl (NZ)-N-(1-phenylpropylidene)carbamate?
The canonical SMILES for ethane;propan-2-yl (NZ)-N-(1-phenylpropylidene)carbamate is CC.CC/C(=N/C(=O)OC(C)C)c1ccccc1.
What is the InChIKey of ethane;propan-2-yl (NZ)-N-(1-phenylpropylidene)carbamate?
The InChIKey is BHFVQVFPRNDKIP-CTMPBGLUSA-N. The full InChI is InChI=1S/C13H17NO2.C2H6/c1-4-12(11-8-6-5-7-9-11)14-13(15)16-10(2)3;1-2/h5-10H,4H2,1-3H3;1-2H3/b14-12-;.
What are the key properties of ethane;propan-2-yl (NZ)-N-(1-phenylpropylidene)carbamate?
ethane;propan-2-yl (NZ)-N-(1-phenylpropylidene)carbamate has a molecular weight of 249.35 g/mol, XLogP of 4.46, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;propan-2-yl (NZ)-N-(1-phenylpropylidene)carbamate is sourced from PubChem (CID 142227813), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).