C32H55BN2O3 — CID 163651092
N-tert-butyl-2-methyl-2-[1-(1-phenylbutyl)piperidin-4-yl]-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hexanamide (PubChem CID 163651092) has the molecular formula C32H55BN2O3 and a molecular weight of 526.62 g/mol. Its IUPAC name is N-tert-butyl-2-methyl-2-[1-(1-phenylbutyl)piperidin-4-yl]-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hexanamide.
| Compound Name | N-tert-butyl-2-methyl-2-[1-(1-phenylbutyl)piperidin-4-yl]-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hexanamide |
|---|---|
| PubChem CID | 163651092 |
| Molecular Formula | C32H55BN2O3 |
| Molecular Weight | 526.62 g/mol |
| Exact Mass | 526.43 |
| IUPAC Name | N-tert-butyl-2-methyl-2-[1-(1-phenylbutyl)piperidin-4-yl]-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hexanamide |
| SMILES | CCCC(c1ccccc1)N1CCC(C(C)(CCCCB2OC(C)(C)C(C)(C)O2)C(=O)NC(C)(C)C)CC1 |
| InChI | InChI=1S/C32H55BN2O3/c1-10-16-27(25-17-12-11-13-18-25)35-23-19-26(20-24-35)32(9,28(36)34-29(2,3)4)21-14-15-22-33-37-30(5,6)31(7,8)38-33/h11-13,17-18,26-27H,10,14-16,19-24H2,1-9H3,(H,34,36) |
| InChIKey | DUNKXWSLGBWNSB-UHFFFAOYSA-N |
| XLogP | 7.42 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.62 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|