C24H37BClN3O5 — CID 66833638
2-acetamido-2-[1-(5-chloro-2-pyridinyl)piperidin-4-yl]-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hexanoic acid (PubChem CID 66833638) has the molecular formula C24H37BClN3O5 and a molecular weight of 493.84 g/mol. Its IUPAC name is 2-acetamido-2-[1-(5-chloro-2-pyridinyl)piperidin-4-yl]-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hexanoic acid.
| Compound Name | 2-acetamido-2-[1-(5-chloro-2-pyridinyl)piperidin-4-yl]-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hexanoic acid |
|---|---|
| PubChem CID | 66833638 |
| Molecular Formula | C24H37BClN3O5 |
| Molecular Weight | 493.84 g/mol |
| Exact Mass | 493.25 |
| IUPAC Name | 2-acetamido-2-[1-(5-chloro-2-pyridinyl)piperidin-4-yl]-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hexanoic acid |
| SMILES | CC(=O)NC(CCCCB1OC(C)(C)C(C)(C)O1)(C(=O)O)C1CCN(c2ccc(Cl)cn2)CC1 |
| InChI | InChI=1S/C24H37BClN3O5/c1-17(30)28-24(21(31)32,12-6-7-13-25-33-22(2,3)23(4,5)34-25)18-10-14-29(15-11-18)20-9-8-19(26)16-27-20/h8-9,16,18H,6-7,10-15H2,1-5H3,(H,28,30)(H,31,32) |
| InChIKey | JHZFHEZQCIGSDW-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 100.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.84 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|